C20H32O6 — CID 162821776
5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid (PubChem CID 162821776) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid.
| Compound Name | 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid |
|---|---|
| PubChem CID | 162821776 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid |
| SMILES | O=C(O)CCCC(O)C(O)C=CC=CC=CC=CC(O)CCCCCO |
| InChI | InChI=1S/C20H32O6/c21-16-9-5-7-12-17(22)11-6-3-1-2-4-8-13-18(23)19(24)14-10-15-20(25)26/h1-4,6,8,11,13,17-19,21-24H,5,7,9-10,12,14-16H2,(H,25,26) |
| InChIKey | JGHYLPPTOXKEKH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|