5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid

C20H32O6 — CID 162821776

IUPAC5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid
SMILESO=C(O)CCCC(O)C(O)C=CC=CC=CC=CC(O)CCCCCO
InChIInChI=1S/C20H32O6/c21-16-9-5-7-12-17(22)11-6-3-1-2-4-8-13-18(23)19(24)14-10-15-20(25)26/h1-4,6,8,11,13,17-19,21-24H,5,7,9-10,12,14-16H2,(H,25,26)
InChIKeyJGHYLPPTOXKEKH-UHFFFAOYSA-N
MW368.47 g/mol
LogP2.10
Rot. Bonds15

About 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid

5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid (PubChem CID 162821776) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid.

Molecular Properties

Compound Name5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid
PubChem CID162821776
Molecular FormulaC20H32O6
Molecular Weight368.47 g/mol
Exact Mass368.22
IUPAC Name5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid
SMILESO=C(O)CCCC(O)C(O)C=CC=CC=CC=CC(O)CCCCCO
InChIInChI=1S/C20H32O6/c21-16-9-5-7-12-17(22)11-6-3-1-2-4-8-13-18(23)19(24)14-10-15-20(25)26/h1-4,6,8,11,13,17-19,21-24H,5,7,9-10,12,14-16H2,(H,25,26)
InChIKeyJGHYLPPTOXKEKH-UHFFFAOYSA-N
XLogP2.10
TPSA118.22 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds15
Heavy Atoms26
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500368.47
LogP ≤ 52.10
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid?
The IUPAC name of 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid (CID 162821776) is 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid.
What is the SMILES notation for 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid?
The canonical SMILES for 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid is O=C(O)CCCC(O)C(O)C=CC=CC=CC=CC(O)CCCCCO.
What is the InChIKey of 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid?
The InChIKey is JGHYLPPTOXKEKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32O6/c21-16-9-5-7-12-17(22)11-6-3-1-2-4-8-13-18(23)19(24)14-10-15-20(25)26/h1-4,6,8,11,13,17-19,21-24H,5,7,9-10,12,14-16H2,(H,25,26).
What are the key properties of 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid?
5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid has a molecular weight of 368.47 g/mol, XLogP of 2.10, 15 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,15,20-tetrahydroxyicosa-7,9,11,13-tetraenoic acid is sourced from PubChem (CID 162821776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).