C23H30O5 — CID 20588555
(6E,8E,10E,12E)-5,14,15-trihydroxy-17-phenylheptadeca-6,8,10,12-tetraenoic acid (PubChem CID 20588555) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (6E,8E,10E,12E)-5,14,15-trihydroxy-17-phenylheptadeca-6,8,10,12-tetraenoic acid.
| Compound Name | (6E,8E,10E,12E)-5,14,15-trihydroxy-17-phenylheptadeca-6,8,10,12-tetraenoic acid |
|---|---|
| PubChem CID | 20588555 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (6E,8E,10E,12E)-5,14,15-trihydroxy-17-phenylheptadeca-6,8,10,12-tetraenoic acid |
| SMILES | O=C(O)CCCC(O)/C=C/C=C/C=C/C=C/C(O)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C23H30O5/c24-20(14-10-16-23(27)28)13-8-3-1-2-4-9-15-21(25)22(26)18-17-19-11-6-5-7-12-19/h1-9,11-13,15,20-22,24-26H,10,14,16-18H2,(H,27,28)/b3-1+,4-2+,13-8+,15-9+ |
| InChIKey | JJIOEZJMDNVADT-NDVZPQIYSA-N |
| XLogP | 3.18 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|