C27H36O4 — CID 157337788
acetylene;(5S,6R,7E,9E,11Z)-5,6-dihydroxy-17-phenylheptadeca-7,9,11-trien-14-ynoic acid;ethane (PubChem CID 157337788) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is acetylene;(5S,6R,7E,9E,11Z)-5,6-dihydroxy-17-phenylheptadeca-7,9,11-trien-14-ynoic acid;ethane.
| Compound Name | acetylene;(5S,6R,7E,9E,11Z)-5,6-dihydroxy-17-phenylheptadeca-7,9,11-trien-14-ynoic acid;ethane |
|---|---|
| PubChem CID | 157337788 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | acetylene;(5S,6R,7E,9E,11Z)-5,6-dihydroxy-17-phenylheptadeca-7,9,11-trien-14-ynoic acid;ethane |
| SMILES | C#C.CC.O=C(O)CCC[C@H](O)[C@H](O)/C=C/C=C/C=C\CC#CCCc1ccccc1 |
| InChI | InChI=1S/C23H28O4.C2H6.C2H2/c24-21(22(25)18-13-19-23(26)27)17-12-7-5-3-1-2-4-6-9-14-20-15-10-8-11-16-20;2*1-2/h1,3,5,7-8,10-12,15-17,21-22,24-25H,2,9,13-14,18-19H2,(H,26,27);1-2H3;1-2H/b3-1-,7-5+,17-12+;;/t21-,22+;;/m1../s1 |
| InChIKey | BGASUBSNTRQNGJ-VQQVMLNSSA-N |
| XLogP | 4.93 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|