(5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid

C20H32O4 — CID 3246879

IUPAC(5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid
SMILESCCCCCC=CCC=CC=CC=C[C@@H](O)[C@@H](O)CCCC(=O)O
InChIInChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(21)19(22)16-14-17-20(23)24/h6-7,9-13,15,18-19,21-22H,2-5,8,14,16-17H2,1H3,(H,23,24)/t18-,19+/m1/s1
InChIKeyUVZBUUTTYHTDRR-MOPGFXCFSA-N
MW336.47 g/mol
LogP4.16
Rot. Bonds14

About (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid

(5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid (PubChem CID 3246879) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid.

Molecular Properties

Compound Name(5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid
PubChem CID3246879
Molecular FormulaC20H32O4
Molecular Weight336.47 g/mol
Exact Mass336.23
IUPAC Name(5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid
SMILESCCCCCC=CCC=CC=CC=C[C@@H](O)[C@@H](O)CCCC(=O)O
InChIInChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(21)19(22)16-14-17-20(23)24/h6-7,9-13,15,18-19,21-22H,2-5,8,14,16-17H2,1H3,(H,23,24)/t18-,19+/m1/s1
InChIKeyUVZBUUTTYHTDRR-MOPGFXCFSA-N
XLogP4.16
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds14
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500336.47
LogP ≤ 54.16
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid?
The IUPAC name of (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid (CID 3246879) is (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid.
What is the SMILES notation for (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid?
The canonical SMILES for (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid is CCCCCC=CCC=CC=CC=C[C@@H](O)[C@@H](O)CCCC(=O)O.
What is the InChIKey of (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid?
The InChIKey is UVZBUUTTYHTDRR-MOPGFXCFSA-N. The full InChI is InChI=1S/C20H32O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(21)19(22)16-14-17-20(23)24/h6-7,9-13,15,18-19,21-22H,2-5,8,14,16-17H2,1H3,(H,23,24)/t18-,19+/m1/s1.
What are the key properties of (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid?
(5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid has a molecular weight of 336.47 g/mol, XLogP of 4.16, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6R)-5,6-dihydroxyicosa-7,9,11,14-tetraenoic acid is sourced from PubChem (CID 3246879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).