C20H32O3S — CID 97304118
(5R,6S,7Z,9Z,11Z,14E)-5-hydroxy-6-sulfanylicosa-7,9,11,14-tetraenoic acid (PubChem CID 97304118) has the molecular formula C20H32O3S and a molecular weight of 352.54 g/mol. Its IUPAC name is (5R,6S,7Z,9Z,11Z,14E)-5-hydroxy-6-sulfanylicosa-7,9,11,14-tetraenoic acid.
| Compound Name | (5R,6S,7Z,9Z,11Z,14E)-5-hydroxy-6-sulfanylicosa-7,9,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 97304118 |
| Molecular Formula | C20H32O3S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (5R,6S,7Z,9Z,11Z,14E)-5-hydroxy-6-sulfanylicosa-7,9,11,14-tetraenoic acid |
| SMILES | CCCCC/C=C/C/C=C\C=C/C=C\[C@H](S)[C@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H32O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-19(24)18(21)15-14-17-20(22)23/h6-7,9-13,16,18-19,21,24H,2-5,8,14-15,17H2,1H3,(H,22,23)/b7-6+,10-9-,12-11-,16-13-/t18-,19+/m1/s1 |
| InChIKey | IWFOTPBOSHKMBA-AIOPANMTSA-N |
| XLogP | 5.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|