C23H37NO5S — CID 162957434
(5S,6R,7E,9E)-6-(2-amino-2-carboxyethyl)sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid (PubChem CID 162957434) has the molecular formula C23H37NO5S and a molecular weight of 439.62 g/mol. Its IUPAC name is (5S,6R,7E,9E)-6-(2-amino-2-carboxyethyl)sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid.
| Compound Name | (5S,6R,7E,9E)-6-(2-amino-2-carboxyethyl)sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 162957434 |
| Molecular Formula | C23H37NO5S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | (5S,6R,7E,9E)-6-(2-amino-2-carboxyethyl)sulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
| SMILES | CCCCCC=CCC=C/C=C/C=C/[C@@H](SCC(N)C(=O)O)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C23H37NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21(30-18-19(24)23(28)29)20(25)15-14-17-22(26)27/h6-7,9-13,16,19-21,25H,2-5,8,14-15,17-18,24H2,1H3,(H,26,27)(H,28,29)/b7-6?,10-9?,12-11+,16-13+/t19?,20-,21+/m0/s1 |
| InChIKey | OTZRAYGBFWZKMX-BGCYIFDCSA-N |
| XLogP | 4.31 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|