C23H39NO5S — CID 53420916
6-(2-amino-2-carboxyethyl)sulfanyl-5-hydroxyicosa-7,9,11-trienoic acid (PubChem CID 53420916) has the molecular formula C23H39NO5S and a molecular weight of 441.63 g/mol. Its IUPAC name is 6-(2-amino-2-carboxyethyl)sulfanyl-5-hydroxyicosa-7,9,11-trienoic acid.
| Compound Name | 6-(2-amino-2-carboxyethyl)sulfanyl-5-hydroxyicosa-7,9,11-trienoic acid |
|---|---|
| PubChem CID | 53420916 |
| Molecular Formula | C23H39NO5S |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 6-(2-amino-2-carboxyethyl)sulfanyl-5-hydroxyicosa-7,9,11-trienoic acid |
| SMILES | CCCCCCCCC=CC=CC=CC(SCC(N)C(=O)O)C(O)CCCC(=O)O |
| InChI | InChI=1S/C23H39NO5S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-21(30-18-19(24)23(28)29)20(25)15-14-17-22(26)27/h9-13,16,19-21,25H,2-8,14-15,17-18,24H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | KRTWHKZMWCZCIK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|