C22H36O3S — CID 88703757
(5S,6R,7E,9Z,11Z,14Z)-6-ethylsulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid (PubChem CID 88703757) has the molecular formula C22H36O3S and a molecular weight of 380.59 g/mol. Its IUPAC name is (5S,6R,7E,9Z,11Z,14Z)-6-ethylsulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid.
| Compound Name | (5S,6R,7E,9Z,11Z,14Z)-6-ethylsulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 88703757 |
| Molecular Formula | C22H36O3S |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | (5S,6R,7E,9Z,11Z,14Z)-6-ethylsulfanyl-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
| SMILES | CCCCC/C=C\C/C=C\C=C/C=C/[C@@H](SCC)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C22H36O3S/c1-3-5-6-7-8-9-10-11-12-13-14-15-18-21(26-4-2)20(23)17-16-19-22(24)25/h8-9,11-15,18,20-21,23H,3-7,10,16-17,19H2,1-2H3,(H,24,25)/b9-8-,12-11-,14-13-,18-15+/t20-,21+/m0/s1 |
| InChIKey | HLKVMUUXZPXDRF-MNPRUZLLSA-N |
| XLogP | 5.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|