C21H40O3S — CID 88703900
(Z,5S,6R)-6-ethylsulfanyl-5-hydroxynonadec-7-enoic acid (PubChem CID 88703900) has the molecular formula C21H40O3S and a molecular weight of 372.62 g/mol. Its IUPAC name is (Z,5S,6R)-6-ethylsulfanyl-5-hydroxynonadec-7-enoic acid.
| Compound Name | (Z,5S,6R)-6-ethylsulfanyl-5-hydroxynonadec-7-enoic acid |
|---|---|
| PubChem CID | 88703900 |
| Molecular Formula | C21H40O3S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (Z,5S,6R)-6-ethylsulfanyl-5-hydroxynonadec-7-enoic acid |
| SMILES | CCCCCCCCCCC/C=C\[C@@H](SCC)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C21H40O3S/c1-3-5-6-7-8-9-10-11-12-13-14-17-20(25-4-2)19(22)16-15-18-21(23)24/h14,17,19-20,22H,3-13,15-16,18H2,1-2H3,(H,23,24)/b17-14-/t19-,20+/m0/s1 |
| InChIKey | HJMSGAOUQUIGPH-FBBFXVNXSA-N |
| XLogP | 6.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|