C23H37NO4S — CID 88701507
(5R,6S,7E,14Z)-6-(2-amino-3-sulfanylpropanoyl)-5-hydroxyicosa-7,9,11,14-tetraenoic acid (PubChem CID 88701507) has the molecular formula C23H37NO4S and a molecular weight of 423.62 g/mol. Its IUPAC name is (5R,6S,7E,14Z)-6-(2-amino-3-sulfanylpropanoyl)-5-hydroxyicosa-7,9,11,14-tetraenoic acid.
| Compound Name | (5R,6S,7E,14Z)-6-(2-amino-3-sulfanylpropanoyl)-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 88701507 |
| Molecular Formula | C23H37NO4S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (5R,6S,7E,14Z)-6-(2-amino-3-sulfanylpropanoyl)-5-hydroxyicosa-7,9,11,14-tetraenoic acid |
| SMILES | CCCCC/C=C\CC=CC=C/C=C/[C@H](C(=O)C(N)CS)[C@H](O)CCCC(=O)O |
| InChI | InChI=1S/C23H37NO4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-19(23(28)20(24)18-29)21(25)16-14-17-22(26)27/h6-7,9-13,15,19-21,25,29H,2-5,8,14,16-18,24H2,1H3,(H,26,27)/b7-6-,10-9?,12-11?,15-13+/t19-,20?,21+/m0/s1 |
| InChIKey | JURWZUIEMTYEOQ-GQYNHGFHSA-N |
| XLogP | 4.24 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|