C25H40N2O6S — CID 118274627
(5S,6R,7E,9E,11Z,13E,15S)-6-[2-[[(2S)-2-amino-3-sulfanylpropanoyl]amino]acetyl]-5,15-dihydroxyicosa-7,9,11,13-tetraenoic acid (PubChem CID 118274627) has the molecular formula C25H40N2O6S and a molecular weight of 496.67 g/mol. Its IUPAC name is (5S,6R,7E,9E,11Z,13E,15S)-6-[2-[[(2S)-2-amino-3-sulfanylpropanoyl]amino]acetyl]-5,15-dihydroxyicosa-7,9,11,13-tetraenoic acid.
| Compound Name | (5S,6R,7E,9E,11Z,13E,15S)-6-[2-[[(2S)-2-amino-3-sulfanylpropanoyl]amino]acetyl]-5,15-dihydroxyicosa-7,9,11,13-tetraenoic acid |
|---|---|
| PubChem CID | 118274627 |
| Molecular Formula | C25H40N2O6S |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (5S,6R,7E,9E,11Z,13E,15S)-6-[2-[[(2S)-2-amino-3-sulfanylpropanoyl]amino]acetyl]-5,15-dihydroxyicosa-7,9,11,13-tetraenoic acid |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C=C\C=C\[C@@H](C(=O)CNC(=O)[C@H](N)CS)[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C25H40N2O6S/c1-2-3-8-12-19(28)13-9-6-4-5-7-10-14-20(22(29)15-11-16-24(31)32)23(30)17-27-25(33)21(26)18-34/h4-7,9-10,13-14,19-22,28-29,34H,2-3,8,11-12,15-18,26H2,1H3,(H,27,33)(H,31,32)/b6-4-,7-5+,13-9+,14-10+/t19-,20+,21+,22-/m0/s1 |
| InChIKey | KZMYRLQESTWHHG-NCRQAAKPSA-N |
| XLogP | 2.33 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|