C23H47N3O4S — CID 87411452
2-[(2-amino-3-sulfanylpropanoyl)amino]acetic acid;octadecanamide (PubChem CID 87411452) has the molecular formula C23H47N3O4S and a molecular weight of 461.71 g/mol. Its IUPAC name is 2-[(2-amino-3-sulfanylpropanoyl)amino]acetic acid;octadecanamide.
| Compound Name | 2-[(2-amino-3-sulfanylpropanoyl)amino]acetic acid;octadecanamide |
|---|---|
| PubChem CID | 87411452 |
| Molecular Formula | C23H47N3O4S |
| Molecular Weight | 461.71 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | 2-[(2-amino-3-sulfanylpropanoyl)amino]acetic acid;octadecanamide |
| SMILES | CCCCCCCCCCCCCCCCCC(N)=O.NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C18H37NO.C5H10N2O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;6-3(2-11)5(10)7-1-4(8)9/h2-17H2,1H3,(H2,19,20);3,11H,1-2,6H2,(H,7,10)(H,8,9) |
| InChIKey | QYNXJGODFMHPRV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.71 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|