C7H14N2O3S — CID 175962096
4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]butanoic acid (PubChem CID 175962096) has the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. Its IUPAC name is 4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]butanoic acid.
| Compound Name | 4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175962096 |
| Molecular Formula | C7H14N2O3S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 4-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]butanoic acid |
| SMILES | N[C@@H](CS)C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C7H14N2O3S/c8-5(4-13)7(12)9-3-1-2-6(10)11/h5,13H,1-4,8H2,(H,9,12)(H,10,11)/t5-/m0/s1 |
| InChIKey | LFZSVYMZKNUKFH-YFKPBYRVSA-N |
| XLogP | -0.78 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|