C14H28N2O3S — CID 123593299
methyl 10-[(2-amino-3-sulfanylpropanoyl)amino]decanoate (PubChem CID 123593299) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is methyl 10-[(2-amino-3-sulfanylpropanoyl)amino]decanoate.
| Compound Name | methyl 10-[(2-amino-3-sulfanylpropanoyl)amino]decanoate |
|---|---|
| PubChem CID | 123593299 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | methyl 10-[(2-amino-3-sulfanylpropanoyl)amino]decanoate |
| SMILES | COC(=O)CCCCCCCCCNC(=O)C(N)CS |
| InChI | InChI=1S/C14H28N2O3S/c1-19-13(17)9-7-5-3-2-4-6-8-10-16-14(18)12(15)11-20/h12,20H,2-11,15H2,1H3,(H,16,18) |
| InChIKey | SXHTVMSRDUDRNE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|