C10H22N4O3S — CID 59993746
methyl N-[2-[3-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]propylamino]ethyl]carbamate (PubChem CID 59993746) has the molecular formula C10H22N4O3S and a molecular weight of 278.38 g/mol. Its IUPAC name is methyl N-[2-[3-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]propylamino]ethyl]carbamate.
| Compound Name | methyl N-[2-[3-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]propylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 59993746 |
| Molecular Formula | C10H22N4O3S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | methyl N-[2-[3-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]propylamino]ethyl]carbamate |
| SMILES | COC(=O)NCCNCCCNC(=O)[C@@H](N)CS |
| InChI | InChI=1S/C10H22N4O3S/c1-17-10(16)14-6-5-12-3-2-4-13-9(15)8(11)7-18/h8,12,18H,2-7,11H2,1H3,(H,13,15)(H,14,16)/t8-/m0/s1 |
| InChIKey | KMRFQQNHMBIMPA-QMMMGPOBSA-N |
| XLogP | -1.30 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|