C14H28N4O4S2 — CID 177145589
ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate (PubChem CID 177145589) has the molecular formula C14H28N4O4S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate.
| Compound Name | ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate |
|---|---|
| PubChem CID | 177145589 |
| Molecular Formula | C14H28N4O4S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate |
| SMILES | CCOC(=O)C(CCCCNC(=O)C(N)CS)NC(=O)C(N)CS |
| InChI | InChI=1S/C14H28N4O4S2/c1-2-22-14(21)11(18-13(20)10(16)8-24)5-3-4-6-17-12(19)9(15)7-23/h9-11,23-24H,2-8,15-16H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | ZZLHRBXQTVJONA-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|