ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate

C14H28N4O4S2 — CID 177145589

IUPACethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate
SMILESCCOC(=O)C(CCCCNC(=O)C(N)CS)NC(=O)C(N)CS
InChIInChI=1S/C14H28N4O4S2/c1-2-22-14(21)11(18-13(20)10(16)8-24)5-3-4-6-17-12(19)9(15)7-23/h9-11,23-24H,2-8,15-16H2,1H3,(H,17,19)(H,18,20)
InChIKeyZZLHRBXQTVJONA-UHFFFAOYSA-N
MW380.54 g/mol
LogP-1.16
Rot. Bonds12

About ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate

ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate (PubChem CID 177145589) has the molecular formula C14H28N4O4S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate.

Molecular Properties

Compound Nameethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate
PubChem CID177145589
Molecular FormulaC14H28N4O4S2
Molecular Weight380.54 g/mol
Exact Mass380.16
IUPAC Nameethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate
SMILESCCOC(=O)C(CCCCNC(=O)C(N)CS)NC(=O)C(N)CS
InChIInChI=1S/C14H28N4O4S2/c1-2-22-14(21)11(18-13(20)10(16)8-24)5-3-4-6-17-12(19)9(15)7-23/h9-11,23-24H,2-8,15-16H2,1H3,(H,17,19)(H,18,20)
InChIKeyZZLHRBXQTVJONA-UHFFFAOYSA-N
XLogP-1.16
TPSA136.54 Ų
H-Bond Donors6
H-Bond Acceptors8
Rotatable Bonds12
Heavy Atoms24
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500380.54
LogP ≤ 5-1.16
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate?
The IUPAC name of ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate (CID 177145589) is ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate.
What is the SMILES notation for ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate?
The canonical SMILES for ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate is CCOC(=O)C(CCCCNC(=O)C(N)CS)NC(=O)C(N)CS.
What is the InChIKey of ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate?
The InChIKey is ZZLHRBXQTVJONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O4S2/c1-2-22-14(21)11(18-13(20)10(16)8-24)5-3-4-6-17-12(19)9(15)7-23/h9-11,23-24H,2-8,15-16H2,1H3,(H,17,19)(H,18,20).
What are the key properties of ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate?
ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate has a molecular weight of 380.54 g/mol, XLogP of -1.16, 12 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,6-bis[(2-amino-3-sulfanylpropanoyl)amino]hexanoate is sourced from PubChem (CID 177145589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).