C18H36N6O5 — CID 20593453
ethyl 2-[[2-amino-6-[1-(hydroxyamino)ethylideneamino]hexanoyl]amino]-6-[1-(hydroxyamino)ethylideneamino]hexanoate (PubChem CID 20593453) has the molecular formula C18H36N6O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is ethyl 2-[[2-amino-6-[1-(hydroxyamino)ethylideneamino]hexanoyl]amino]-6-[1-(hydroxyamino)ethylideneamino]hexanoate.
| Compound Name | ethyl 2-[[2-amino-6-[1-(hydroxyamino)ethylideneamino]hexanoyl]amino]-6-[1-(hydroxyamino)ethylideneamino]hexanoate |
|---|---|
| PubChem CID | 20593453 |
| Molecular Formula | C18H36N6O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | ethyl 2-[[2-amino-6-[1-(hydroxyamino)ethylideneamino]hexanoyl]amino]-6-[1-(hydroxyamino)ethylideneamino]hexanoate |
| SMILES | CCOC(=O)C(CCCC/N=C(\C)NO)NC(=O)C(N)CCCC/N=C(\C)NO |
| InChI | InChI=1S/C18H36N6O5/c1-4-29-18(26)16(10-6-8-12-21-14(3)24-28)22-17(25)15(19)9-5-7-11-20-13(2)23-27/h15-16,27-28H,4-12,19H2,1-3H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | CQYZARPJACUSMD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 170.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|