C17H33N3O5 — CID 91170836
tert-butyl 6-[1-(hydroxyamino)ethylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 91170836) has the molecular formula C17H33N3O5 and a molecular weight of 359.47 g/mol. Its IUPAC name is tert-butyl 6-[1-(hydroxyamino)ethylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | tert-butyl 6-[1-(hydroxyamino)ethylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 91170836 |
| Molecular Formula | C17H33N3O5 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | tert-butyl 6-[1-(hydroxyamino)ethylideneamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | C/C(=N\CCCCC(NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)NO |
| InChI | InChI=1S/C17H33N3O5/c1-12(20-23)18-11-9-8-10-13(14(21)24-16(2,3)4)19-15(22)25-17(5,6)7/h13,23H,8-11H2,1-7H3,(H,18,20)(H,19,22) |
| InChIKey | PMYYZBDJWQXXBT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|