C18H38N10O4 — CID 91169024
[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] (2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoate (PubChem CID 91169024) has the molecular formula C18H38N10O4 and a molecular weight of 458.57 g/mol. Its IUPAC name is [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] (2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoate.
| Compound Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] (2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 91169024 |
| Molecular Formula | C18H38N10O4 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | [(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl] (2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoate |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)CCCN=C(N)N)C(=O)OC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C18H38N10O4/c19-8-2-1-7-13(28-14(29)11(20)5-3-9-26-17(22)23)16(31)32-15(30)12(21)6-4-10-27-18(24)25/h11-13H,1-10,19-21H2,(H,28,29)(H4,22,23,26)(H4,24,25,27)/t11-,12-,13-/m0/s1 |
| InChIKey | IZTKMBKCZPWAES-AVGNSLFASA-N |
| XLogP | -3.57 |
| TPSA | 279.33 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|