C21H42N4O3 — CID 59033718
(2S)-2-amino-N-[(2S)-1-[[(2S)-1-amino-1-oxoheptan-2-yl]amino]-1-oxoheptan-2-yl]heptanamide (PubChem CID 59033718) has the molecular formula C21H42N4O3 and a molecular weight of 398.59 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1-[[(2S)-1-amino-1-oxoheptan-2-yl]amino]-1-oxoheptan-2-yl]heptanamide.
| Compound Name | (2S)-2-amino-N-[(2S)-1-[[(2S)-1-amino-1-oxoheptan-2-yl]amino]-1-oxoheptan-2-yl]heptanamide |
|---|---|
| PubChem CID | 59033718 |
| Molecular Formula | C21H42N4O3 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.33 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1-[[(2S)-1-amino-1-oxoheptan-2-yl]amino]-1-oxoheptan-2-yl]heptanamide |
| SMILES | CCCCC[C@H](NC(=O)[C@H](CCCCC)NC(=O)[C@@H](N)CCCCC)C(N)=O |
| InChI | InChI=1S/C21H42N4O3/c1-4-7-10-13-16(22)20(27)25-18(15-12-9-6-3)21(28)24-17(19(23)26)14-11-8-5-2/h16-18H,4-15,22H2,1-3H3,(H2,23,26)(H,24,28)(H,25,27)/t16-,17-,18-/m0/s1 |
| InChIKey | JCJCELYQIDFRBH-BZSNNMDCSA-N |
| XLogP | 2.51 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|