C48H94N6O6 — CID 159407083
2-amino-N-[1-[(2-methyl-3-oxononan-4-yl)amino]-1-oxoheptan-2-yl]heptanamide (PubChem CID 159407083) has the molecular formula C48H94N6O6 and a molecular weight of 851.32 g/mol. Its IUPAC name is 2-amino-N-[1-[(2-methyl-3-oxononan-4-yl)amino]-1-oxoheptan-2-yl]heptanamide.
| Compound Name | 2-amino-N-[1-[(2-methyl-3-oxononan-4-yl)amino]-1-oxoheptan-2-yl]heptanamide |
|---|---|
| PubChem CID | 159407083 |
| Molecular Formula | C48H94N6O6 |
| Molecular Weight | 851.32 g/mol |
| Exact Mass | 850.72 |
| IUPAC Name | 2-amino-N-[1-[(2-methyl-3-oxononan-4-yl)amino]-1-oxoheptan-2-yl]heptanamide |
| SMILES | CCCCCC(N)C(=O)NC(CCCCC)C(=O)NC(CCCCC)C(=O)C(C)C.CCCCCC(N)C(=O)NC(CCCCC)C(=O)NC(CCCCC)C(=O)C(C)C |
| InChI | InChI=1S/2C24H47N3O3/c2*1-6-9-12-15-19(25)23(29)27-21(17-14-11-8-3)24(30)26-20(16-13-10-7-2)22(28)18(4)5/h2*18-21H,6-17,25H2,1-5H3,(H,26,30)(H,27,29) |
| InChIKey | LOCDXSBJJOCXQM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 202.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.32 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|