C22H43N3O3 — CID 87813110
(2S)-6-amino-2-(octanoylamino)-7-oxotetradecanamide (PubChem CID 87813110) has the molecular formula C22H43N3O3 and a molecular weight of 397.60 g/mol. Its IUPAC name is (2S)-6-amino-2-(octanoylamino)-7-oxotetradecanamide.
| Compound Name | (2S)-6-amino-2-(octanoylamino)-7-oxotetradecanamide |
|---|---|
| PubChem CID | 87813110 |
| Molecular Formula | C22H43N3O3 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.33 |
| IUPAC Name | (2S)-6-amino-2-(octanoylamino)-7-oxotetradecanamide |
| SMILES | CCCCCCCC(=O)N[C@@H](CCCC(N)C(=O)CCCCCCC)C(N)=O |
| InChI | InChI=1S/C22H43N3O3/c1-3-5-7-9-11-16-20(26)18(23)14-13-15-19(22(24)28)25-21(27)17-12-10-8-6-4-2/h18-19H,3-17,23H2,1-2H3,(H2,24,28)(H,25,27)/t18?,19-/m0/s1 |
| InChIKey | AZCIWHCNIMKJAB-GGYWPGCISA-N |
| XLogP | 3.74 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|