C22H48N6O3 — CID 170598010
methanamine;2-[[6-(methylamino)-2-[2-(methylamino)hexanoylamino]hexanoyl]amino]heptanamide (PubChem CID 170598010) has the molecular formula C22H48N6O3 and a molecular weight of 444.67 g/mol. Its IUPAC name is methanamine;2-[[6-(methylamino)-2-[2-(methylamino)hexanoylamino]hexanoyl]amino]heptanamide.
| Compound Name | methanamine;2-[[6-(methylamino)-2-[2-(methylamino)hexanoylamino]hexanoyl]amino]heptanamide |
|---|---|
| PubChem CID | 170598010 |
| Molecular Formula | C22H48N6O3 |
| Molecular Weight | 444.67 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | methanamine;2-[[6-(methylamino)-2-[2-(methylamino)hexanoylamino]hexanoyl]amino]heptanamide |
| SMILES | CCCCCC(NC(=O)C(CCCCNC)NC(=O)C(CCCC)NC)C(N)=O.CN |
| InChI | InChI=1S/C21H43N5O3.CH5N/c1-5-7-9-13-16(19(22)27)25-21(29)18(14-10-11-15-23-3)26-20(28)17(24-4)12-8-6-2;1-2/h16-18,23-24H,5-15H2,1-4H3,(H2,22,27)(H,25,29)(H,26,28);2H2,1H3 |
| InChIKey | VCKLJBIVHFIYQM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.67 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|