C16H35N3O3 — CID 142905874
2-[2,6-bis(methylamino)hexanoylamino]hexanoic acid;ethane (PubChem CID 142905874) has the molecular formula C16H35N3O3 and a molecular weight of 317.47 g/mol. Its IUPAC name is 2-[2,6-bis(methylamino)hexanoylamino]hexanoic acid;ethane.
| Compound Name | 2-[2,6-bis(methylamino)hexanoylamino]hexanoic acid;ethane |
|---|---|
| PubChem CID | 142905874 |
| Molecular Formula | C16H35N3O3 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | 2-[2,6-bis(methylamino)hexanoylamino]hexanoic acid;ethane |
| SMILES | CC.CCCCC(NC(=O)C(CCCCNC)NC)C(=O)O |
| InChI | InChI=1S/C14H29N3O3.C2H6/c1-4-5-8-12(14(19)20)17-13(18)11(16-3)9-6-7-10-15-2;1-2/h11-12,15-16H,4-10H2,1-3H3,(H,17,18)(H,19,20);1-2H3 |
| InChIKey | BTCNJSNGDKNGNY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|