C22H41N3O3 — CID 142905881
2-[2,6-bis(methylamino)hexanoylamino]-3-cyclohepta-1,4,6-trien-1-ylpropanoic acid;ethane (PubChem CID 142905881) has the molecular formula C22H41N3O3 and a molecular weight of 395.59 g/mol. Its IUPAC name is 2-[2,6-bis(methylamino)hexanoylamino]-3-cyclohepta-1,4,6-trien-1-ylpropanoic acid;ethane.
| Compound Name | 2-[2,6-bis(methylamino)hexanoylamino]-3-cyclohepta-1,4,6-trien-1-ylpropanoic acid;ethane |
|---|---|
| PubChem CID | 142905881 |
| Molecular Formula | C22H41N3O3 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.31 |
| IUPAC Name | 2-[2,6-bis(methylamino)hexanoylamino]-3-cyclohepta-1,4,6-trien-1-ylpropanoic acid;ethane |
| SMILES | CC.CC.CNCCCCC(NC)C(=O)NC(CC1=CCC=CC=C1)C(=O)O |
| InChI | InChI=1S/C18H29N3O3.2C2H6/c1-19-12-8-7-11-15(20-2)17(22)21-16(18(23)24)13-14-9-5-3-4-6-10-14;2*1-2/h3-5,9-10,15-16,19-20H,6-8,11-13H2,1-2H3,(H,21,22)(H,23,24);2*1-2H3 |
| InChIKey | ACCNVHPHQVLVHZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|