C24H49N5O4 — CID 157301898
methyl 2-[2,6-bis(methylamino)hexanoylamino]-9,13-bis(methylamino)-8-oxotridecanoate (PubChem CID 157301898) has the molecular formula C24H49N5O4 and a molecular weight of 471.69 g/mol. Its IUPAC name is methyl 2-[2,6-bis(methylamino)hexanoylamino]-9,13-bis(methylamino)-8-oxotridecanoate.
| Compound Name | methyl 2-[2,6-bis(methylamino)hexanoylamino]-9,13-bis(methylamino)-8-oxotridecanoate |
|---|---|
| PubChem CID | 157301898 |
| Molecular Formula | C24H49N5O4 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.38 |
| IUPAC Name | methyl 2-[2,6-bis(methylamino)hexanoylamino]-9,13-bis(methylamino)-8-oxotridecanoate |
| SMILES | CNCCCCC(NC)C(=O)CCCCCC(NC(=O)C(CCCCNC)NC)C(=O)OC |
| InChI | InChI=1S/C24H49N5O4/c1-25-17-11-9-13-19(27-3)22(30)16-8-6-7-15-21(24(32)33-5)29-23(31)20(28-4)14-10-12-18-26-2/h19-21,25-28H,6-18H2,1-5H3,(H,29,31) |
| InChIKey | TYZOXRIKLUQQCY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|