C24H49N3O2 — CID 160870379
N-[15-(butylamino)-1-(methylamino)-6-oxopentadecan-5-yl]butanamide (PubChem CID 160870379) has the molecular formula C24H49N3O2 and a molecular weight of 411.68 g/mol. Its IUPAC name is N-[15-(butylamino)-1-(methylamino)-6-oxopentadecan-5-yl]butanamide.
| Compound Name | N-[15-(butylamino)-1-(methylamino)-6-oxopentadecan-5-yl]butanamide |
|---|---|
| PubChem CID | 160870379 |
| Molecular Formula | C24H49N3O2 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.38 |
| IUPAC Name | N-[15-(butylamino)-1-(methylamino)-6-oxopentadecan-5-yl]butanamide |
| SMILES | CCCCNCCCCCCCCCC(=O)C(CCCCNC)NC(=O)CCC |
| InChI | InChI=1S/C24H49N3O2/c1-4-6-20-26-21-14-11-9-7-8-10-12-18-23(28)22(17-13-15-19-25-3)27-24(29)16-5-2/h22,25-26H,4-21H2,1-3H3,(H,27,29) |
| InChIKey | NCARZGVIUABGCQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|