3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid

C11H15NO2 — CID 123974730

IUPAC3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid
SMILESCNC(CC1=CC=CCC=C1)C(=O)O
InChIInChI=1S/C11H15NO2/c1-12-10(11(13)14)8-9-6-4-2-3-5-7-9/h2,4-7,10,12H,3,8H2,1H3,(H,13,14)
InChIKeyCJFMJUPVMCAWPG-UHFFFAOYSA-N
MW193.25 g/mol
LogP1.49
Rot. Bonds4

About 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid

3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid (PubChem CID 123974730) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid.

Molecular Properties

Compound Name3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid
PubChem CID123974730
Molecular FormulaC11H15NO2
Molecular Weight193.25 g/mol
Exact Mass193.11
IUPAC Name3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid
SMILESCNC(CC1=CC=CCC=C1)C(=O)O
InChIInChI=1S/C11H15NO2/c1-12-10(11(13)14)8-9-6-4-2-3-5-7-9/h2,4-7,10,12H,3,8H2,1H3,(H,13,14)
InChIKeyCJFMJUPVMCAWPG-UHFFFAOYSA-N
XLogP1.49
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.25
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid?
The IUPAC name of 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid (CID 123974730) is 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid.
What is the SMILES notation for 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid?
The canonical SMILES for 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid is CNC(CC1=CC=CCC=C1)C(=O)O.
What is the InChIKey of 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid?
The InChIKey is CJFMJUPVMCAWPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-12-10(11(13)14)8-9-6-4-2-3-5-7-9/h2,4-7,10,12H,3,8H2,1H3,(H,13,14).
What are the key properties of 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid?
3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid has a molecular weight of 193.25 g/mol, XLogP of 1.49, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohepta-1,3,6-trien-1-yl-2-(methylamino)propanoic acid is sourced from PubChem (CID 123974730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).