C10H13BrClNO2 — CID 167716194
3-(4-bromophenyl)-2-(methylamino)propanoic acid;hydrochloride (PubChem CID 167716194) has the molecular formula C10H13BrClNO2 and a molecular weight of 294.58 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-(methylamino)propanoic acid;hydrochloride.
| Compound Name | 3-(4-bromophenyl)-2-(methylamino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 167716194 |
| Molecular Formula | C10H13BrClNO2 |
| Molecular Weight | 294.58 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 3-(4-bromophenyl)-2-(methylamino)propanoic acid;hydrochloride |
| SMILES | CNC(Cc1ccc(Br)cc1)C(=O)O.Cl |
| InChI | InChI=1S/C10H12BrNO2.ClH/c1-12-9(10(13)14)6-7-2-4-8(11)5-3-7;/h2-5,9,12H,6H2,1H3,(H,13,14);1H |
| InChIKey | RFQBDHUTVWMAEF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |