C15H30N4O4S — CID 170966325
6-(methylamino)-2-[[2-[[2-(methylamino)-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 170966325) has the molecular formula C15H30N4O4S and a molecular weight of 362.50 g/mol. Its IUPAC name is 6-(methylamino)-2-[[2-[[2-(methylamino)-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-(methylamino)-2-[[2-[[2-(methylamino)-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 170966325 |
| Molecular Formula | C15H30N4O4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 6-(methylamino)-2-[[2-[[2-(methylamino)-4-methylsulfanylbutanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CNCCCCC(NC(=O)CNC(=O)C(CCSC)NC)C(=O)O |
| InChI | InChI=1S/C15H30N4O4S/c1-16-8-5-4-6-12(15(22)23)19-13(20)10-18-14(21)11(17-2)7-9-24-3/h11-12,16-17H,4-10H2,1-3H3,(H,18,21)(H,19,20)(H,22,23) |
| InChIKey | WWEMZVQDZGSHHN-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|