C19H38N10O5S — CID 18245421
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18245421) has the molecular formula C19H38N10O5S and a molecular weight of 518.65 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18245421 |
| Molecular Formula | C19H38N10O5S |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CCCN=C(N)N)C(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H38N10O5S/c1-35-9-6-12(29-15(31)11(20)4-2-7-25-18(21)22)16(32)27-10-14(30)28-13(17(33)34)5-3-8-26-19(23)24/h11-13H,2-10,20H2,1H3,(H,27,32)(H,28,30)(H,29,31)(H,33,34)(H4,21,22,25)(H4,23,24,26) |
| InChIKey | HFVAGKYPZXKGIY-UHFFFAOYSA-N |
| XLogP | -3.66 |
| TPSA | 279.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|