C22H38N8O10S — CID 175819743
(2S)-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-4-carboxybutanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid (PubChem CID 175819743) has the molecular formula C22H38N8O10S and a molecular weight of 606.66 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-4-carboxybutanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-4-carboxybutanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 175819743 |
| Molecular Formula | C22H38N8O10S |
| Molecular Weight | 606.66 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[2-[[(2S)-2-amino-4-carboxybutanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylsulfanylbutanoyl]amino]butanedioic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)CNC(=O)[C@@H](N)CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H38N8O10S/c1-41-8-6-13(20(38)30-14(21(39)40)9-17(34)35)29-19(37)12(3-2-7-26-22(24)25)28-15(31)10-27-18(36)11(23)4-5-16(32)33/h11-14H,2-10,23H2,1H3,(H,27,36)(H,28,31)(H,29,37)(H,30,38)(H,32,33)(H,34,35)(H,39,40)(H4,24,25,26)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | VRCQFERZULLJQA-XUXIUFHCSA-N |
| XLogP | -3.88 |
| TPSA | 318.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.66 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|