C17H32N8O6S — CID 22652628
2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]acetyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 22652628) has the molecular formula C17H32N8O6S and a molecular weight of 476.56 g/mol. Its IUPAC name is 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]acetyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]acetyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 22652628 |
| Molecular Formula | C17H32N8O6S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-[[2-[[5-(diaminomethylideneamino)-2-[(2,4-diamino-4-oxobutanoyl)amino]pentanoyl]amino]acetyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)CNC(=O)C(CCCN=C(N)N)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H32N8O6S/c1-32-6-4-11(16(30)31)24-13(27)8-23-15(29)10(3-2-5-22-17(20)21)25-14(28)9(18)7-12(19)26/h9-11H,2-8,18H2,1H3,(H2,19,26)(H,23,29)(H,24,27)(H,25,28)(H,30,31)(H4,20,21,22) |
| InChIKey | YPKRJDBVKNGTDK-UHFFFAOYSA-N |
| XLogP | -3.83 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|