C15H26N2O7 — CID 137495952
diethyl (2R)-2-[[(2R)-2-amino-5-methoxy-5-oxopentanoyl]amino]pentanedioate (PubChem CID 137495952) has the molecular formula C15H26N2O7 and a molecular weight of 346.38 g/mol. Its IUPAC name is diethyl (2R)-2-[[(2R)-2-amino-5-methoxy-5-oxopentanoyl]amino]pentanedioate.
| Compound Name | diethyl (2R)-2-[[(2R)-2-amino-5-methoxy-5-oxopentanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 137495952 |
| Molecular Formula | C15H26N2O7 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | diethyl (2R)-2-[[(2R)-2-amino-5-methoxy-5-oxopentanoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@@H](NC(=O)[C@H](N)CCC(=O)OC)C(=O)OCC |
| InChI | InChI=1S/C15H26N2O7/c1-4-23-13(19)9-7-11(15(21)24-5-2)17-14(20)10(16)6-8-12(18)22-3/h10-11H,4-9,16H2,1-3H3,(H,17,20)/t10-,11-/m1/s1 |
| InChIKey | TWLHXEKQYVAFQB-GHMZBOCLSA-N |
| XLogP | -0.34 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|