C31H49N3O13 — CID 144671216
dimethyl 2-aminopentanedioate;dimethyl 2-[(1-ethoxy-1,5-dioxo-5-phenylmethoxypentan-2-yl)carbamoylamino]pentanedioate;ethane (PubChem CID 144671216) has the molecular formula C31H49N3O13 and a molecular weight of 671.74 g/mol. Its IUPAC name is dimethyl 2-aminopentanedioate;dimethyl 2-[(1-ethoxy-1,5-dioxo-5-phenylmethoxypentan-2-yl)carbamoylamino]pentanedioate;ethane.
| Compound Name | dimethyl 2-aminopentanedioate;dimethyl 2-[(1-ethoxy-1,5-dioxo-5-phenylmethoxypentan-2-yl)carbamoylamino]pentanedioate;ethane |
|---|---|
| PubChem CID | 144671216 |
| Molecular Formula | C31H49N3O13 |
| Molecular Weight | 671.74 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | dimethyl 2-aminopentanedioate;dimethyl 2-[(1-ethoxy-1,5-dioxo-5-phenylmethoxypentan-2-yl)carbamoylamino]pentanedioate;ethane |
| SMILES | CC.CCOC(=O)C(CCC(=O)OCc1ccccc1)NC(=O)NC(CCC(=O)OC)C(=O)OC.COC(=O)CCC(N)C(=O)OC |
| InChI | InChI=1S/C22H30N2O9.C7H13NO4.C2H6/c1-4-32-21(28)17(11-13-19(26)33-14-15-8-6-5-7-9-15)24-22(29)23-16(20(27)31-3)10-12-18(25)30-2;1-11-6(9)4-3-5(8)7(10)12-2;1-2/h5-9,16-17H,4,10-14H2,1-3H3,(H2,23,24,29);5H,3-4,8H2,1-2H3;1-2H3 |
| InChIKey | VEQUJIPMUUCYTK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 224.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.74 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|