C10H16N2O7 — CID 107824352
(2R)-2-[(2-amino-3-carboxypropanoyl)amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107824352) has the molecular formula C10H16N2O7 and a molecular weight of 276.25 g/mol. Its IUPAC name is (2R)-2-[(2-amino-3-carboxypropanoyl)amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[(2-amino-3-carboxypropanoyl)amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107824352 |
| Molecular Formula | C10H16N2O7 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (2R)-2-[(2-amino-3-carboxypropanoyl)amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)C(N)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O7/c1-19-8(15)3-2-6(10(17)18)12-9(16)5(11)4-7(13)14/h5-6H,2-4,11H2,1H3,(H,12,16)(H,13,14)(H,17,18)/t5?,6-/m1/s1 |
| InChIKey | KNGLVEVDCBJPMM-PRJDIBJQSA-N |
| XLogP | -1.69 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |