C9H16N2O6 — CID 81089262
(2S)-2-[(2-amino-3-methoxypropanoyl)amino]pentanedioic acid (PubChem CID 81089262) has the molecular formula C9H16N2O6 and a molecular weight of 248.23 g/mol. Its IUPAC name is (2S)-2-[(2-amino-3-methoxypropanoyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(2-amino-3-methoxypropanoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 81089262 |
| Molecular Formula | C9H16N2O6 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (2S)-2-[(2-amino-3-methoxypropanoyl)amino]pentanedioic acid |
| SMILES | COCC(N)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O6/c1-17-4-5(10)8(14)11-6(9(15)16)2-3-7(12)13/h5-6H,2-4,10H2,1H3,(H,11,14)(H,12,13)(H,15,16)/t5?,6-/m0/s1 |
| InChIKey | QQQYJZCQYRPBDJ-GDVGLLTNSA-N |
| XLogP | -1.61 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |