C32H58N6O8S4 — CID 89168043
ethyl 2,6-bis[2,6-bis(3-sulfanylpropanoylamino)hexanoylamino]hexanoate (PubChem CID 89168043) has the molecular formula C32H58N6O8S4 and a molecular weight of 783.12 g/mol. Its IUPAC name is ethyl 2,6-bis[2,6-bis(3-sulfanylpropanoylamino)hexanoylamino]hexanoate.
| Compound Name | ethyl 2,6-bis[2,6-bis(3-sulfanylpropanoylamino)hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 89168043 |
| Molecular Formula | C32H58N6O8S4 |
| Molecular Weight | 783.12 g/mol |
| Exact Mass | 782.32 |
| IUPAC Name | ethyl 2,6-bis[2,6-bis(3-sulfanylpropanoylamino)hexanoylamino]hexanoate |
| SMILES | CCOC(=O)C(CCCCNC(=O)C(CCCCNC(=O)CCS)NC(=O)CCS)NC(=O)C(CCCCNC(=O)CCS)NC(=O)CCS |
| InChI | InChI=1S/C32H58N6O8S4/c1-2-46-32(45)25(38-31(44)24(37-29(42)15-22-50)10-4-7-17-34-27(40)13-20-48)11-5-8-18-35-30(43)23(36-28(41)14-21-49)9-3-6-16-33-26(39)12-19-47/h23-25,47-50H,2-22H2,1H3,(H,33,39)(H,34,40)(H,35,43)(H,36,41)(H,37,42)(H,38,44) |
| InChIKey | FBFMENRBLRMBET-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 200.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|