About (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride
(2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride (PubChem CID 139691176) has the molecular formula C5H13ClN2OS
and a molecular weight of 184.69 g/mol. Its IUPAC name is (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride.
Molecular Properties
| Compound Name | (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride |
| PubChem CID | 139691176 |
| Molecular Formula | C5H13ClN2OS |
| Molecular Weight | 184.69 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride |
| SMILES | CCNC(=O)[C@@H](N)CS.Cl |
| InChI | InChI=1S/C5H12N2OS.ClH/c1-2-7-5(8)4(6)3-9;/h4,9H,2-3,6H2,1H3,(H,7,8);1H/t4-;/m0./s1 |
| InChIKey | MYVODGVIZPDMEY-WCCKRBBISA-N |
| XLogP | -0.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.69 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride?
The IUPAC name of (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride (CID 139691176) is (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride.
What is the SMILES notation for (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride?
The canonical SMILES for (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride is CCNC(=O)[C@@H](N)CS.Cl.
What is the InChIKey of (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride?
The InChIKey is MYVODGVIZPDMEY-WCCKRBBISA-N. The full InChI is InChI=1S/C5H12N2OS.ClH/c1-2-7-5(8)4(6)3-9;/h4,9H,2-3,6H2,1H3,(H,7,8);1H/t4-;/m0./s1.
What are the key properties of (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride?
(2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride has a molecular weight of 184.69 g/mol, XLogP of -0.20, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N-ethyl-3-sulfanylpropanamide;hydrochloride is sourced from PubChem (CID 139691176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).