C7H17ClN2OS — CID 88724401
(2R)-N-ethyl-2-(ethylamino)-3-sulfanylpropanamide;hydrochloride (PubChem CID 88724401) has the molecular formula C7H17ClN2OS and a molecular weight of 212.75 g/mol. Its IUPAC name is (2R)-N-ethyl-2-(ethylamino)-3-sulfanylpropanamide;hydrochloride.
| Compound Name | (2R)-N-ethyl-2-(ethylamino)-3-sulfanylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 88724401 |
| Molecular Formula | C7H17ClN2OS |
| Molecular Weight | 212.75 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (2R)-N-ethyl-2-(ethylamino)-3-sulfanylpropanamide;hydrochloride |
| SMILES | CCNC(=O)[C@H](CS)NCC.Cl |
| InChI | InChI=1S/C7H16N2OS.ClH/c1-3-8-6(5-11)7(10)9-4-2;/h6,8,11H,3-5H2,1-2H3,(H,9,10);1H/t6-;/m0./s1 |
| InChIKey | LKANCBBTFVQMFC-RGMNGODLSA-N |
| XLogP | 0.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.75 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|