C9H18N2O3S2 — CID 23104760
2-[[1-oxo-3-sulfanyl-1-(4-sulfanylbutylamino)propan-2-yl]amino]acetic acid (PubChem CID 23104760) has the molecular formula C9H18N2O3S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 2-[[1-oxo-3-sulfanyl-1-(4-sulfanylbutylamino)propan-2-yl]amino]acetic acid.
| Compound Name | 2-[[1-oxo-3-sulfanyl-1-(4-sulfanylbutylamino)propan-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 23104760 |
| Molecular Formula | C9H18N2O3S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-[[1-oxo-3-sulfanyl-1-(4-sulfanylbutylamino)propan-2-yl]amino]acetic acid |
| SMILES | O=C(O)CNC(CS)C(=O)NCCCCS |
| InChI | InChI=1S/C9H18N2O3S2/c12-8(13)5-11-7(6-16)9(14)10-3-1-2-4-15/h7,11,15-16H,1-6H2,(H,10,14)(H,12,13) |
| InChIKey | YKKLTUHYFMZYAU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|