C7H12N2O5S — CID 144508939
2-[[2-(methoxycarbonylamino)-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 144508939) has the molecular formula C7H12N2O5S and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-[[2-(methoxycarbonylamino)-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-(methoxycarbonylamino)-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 144508939 |
| Molecular Formula | C7H12N2O5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-[[2-(methoxycarbonylamino)-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | COC(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C7H12N2O5S/c1-14-7(13)9-4(3-15)6(12)8-2-5(10)11/h4,15H,2-3H2,1H3,(H,8,12)(H,9,13)(H,10,11) |
| InChIKey | FLMNKIKCBSXYLQ-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|