C8H13N3O6S — CID 59990912
(2S)-2-amino-3-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-3-oxopropanoic acid (PubChem CID 59990912) has the molecular formula C8H13N3O6S and a molecular weight of 279.27 g/mol. Its IUPAC name is (2S)-2-amino-3-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-3-oxopropanoic acid.
| Compound Name | (2S)-2-amino-3-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 59990912 |
| Molecular Formula | C8H13N3O6S |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (2S)-2-amino-3-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-3-oxopropanoic acid |
| SMILES | N[C@H](C(=O)O)C(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C8H13N3O6S/c9-5(8(16)17)7(15)11-3(2-18)6(14)10-1-4(12)13/h3,5,18H,1-2,9H2,(H,10,14)(H,11,15)(H,12,13)(H,16,17)/t3?,5-/m0/s1 |
| InChIKey | CEVSKQITCDEZQS-PVPKANODSA-N |
| XLogP | -2.99 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|