C9H15N3O6 — CID 134318711
(2S)-2-amino-3-[[1-(carboxymethylamino)-1-oxobutan-2-yl]amino]-3-oxopropanoic acid (PubChem CID 134318711) has the molecular formula C9H15N3O6 and a molecular weight of 261.23 g/mol. Its IUPAC name is (2S)-2-amino-3-[[1-(carboxymethylamino)-1-oxobutan-2-yl]amino]-3-oxopropanoic acid.
| Compound Name | (2S)-2-amino-3-[[1-(carboxymethylamino)-1-oxobutan-2-yl]amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 134318711 |
| Molecular Formula | C9H15N3O6 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (2S)-2-amino-3-[[1-(carboxymethylamino)-1-oxobutan-2-yl]amino]-3-oxopropanoic acid |
| SMILES | CCC(NC(=O)[C@H](N)C(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C9H15N3O6/c1-2-4(7(15)11-3-5(13)14)12-8(16)6(10)9(17)18/h4,6H,2-3,10H2,1H3,(H,11,15)(H,12,16)(H,13,14)(H,17,18)/t4?,6-/m0/s1 |
| InChIKey | HPCWRXNKDWNMLG-RZKHNPSRSA-N |
| XLogP | -2.51 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|