C13H24N4O5S — CID 18294294
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]acetyl]amino]-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 18294294) has the molecular formula C13H24N4O5S and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]acetyl]amino]-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]acetyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18294294 |
| Molecular Formula | C13H24N4O5S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]acetyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | CCC(C)C(N)C(=O)NCC(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H24N4O5S/c1-3-7(2)11(14)13(22)15-4-9(18)17-8(6-23)12(21)16-5-10(19)20/h7-8,11,23H,3-6,14H2,1-2H3,(H,15,22)(H,16,21)(H,17,18)(H,19,20) |
| InChIKey | QZDCJOYTHXPRPC-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|