C20H30N4O5S — CID 18502355
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 18502355) has the molecular formula C20H30N4O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18502355 |
| Molecular Formula | C20H30N4O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CS)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H30N4O5S/c1-3-12(2)17(21)19(27)24-15(11-30)18(26)22-10-16(25)23-14(20(28)29)9-13-7-5-4-6-8-13/h4-8,12,14-15,17,30H,3,9-11,21H2,1-2H3,(H,22,26)(H,23,25)(H,24,27)(H,28,29) |
| InChIKey | VLIJKIZCCBKYJY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|