C21H32N4O5S — CID 18500866
2-[[2-[2-[(2-amino-3-methylpentanoyl)amino]propanoylamino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18500866) has the molecular formula C21H32N4O5S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-[[2-[2-[(2-amino-3-methylpentanoyl)amino]propanoylamino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[2-[(2-amino-3-methylpentanoyl)amino]propanoylamino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18500866 |
| Molecular Formula | C21H32N4O5S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 2-[[2-[2-[(2-amino-3-methylpentanoyl)amino]propanoylamino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(C)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C21H32N4O5S/c1-4-12(2)17(22)20(28)23-13(3)18(26)24-15(10-14-8-6-5-7-9-14)19(27)25-16(11-31)21(29)30/h5-9,12-13,15-17,31H,4,10-11,22H2,1-3H3,(H,23,28)(H,24,26)(H,25,27)(H,29,30) |
| InChIKey | QNZKMYIAQCZPCL-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|