C23H34N4O7S — CID 18502467
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid (PubChem CID 18502467) has the molecular formula C23H34N4O7S and a molecular weight of 510.61 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18502467 |
| Molecular Formula | C23H34N4O7S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]pentanedioic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CS)C(=O)NC(Cc1ccccc1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H34N4O7S/c1-3-13(2)19(24)22(32)27-17(12-35)21(31)26-16(11-14-7-5-4-6-8-14)20(30)25-15(23(33)34)9-10-18(28)29/h4-8,13,15-17,19,35H,3,9-12,24H2,1-2H3,(H,25,30)(H,26,31)(H,27,32)(H,28,29)(H,33,34) |
| InChIKey | BKPNCSCGFRVINV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|