C23H34N4O8 — CID 18296904
2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid (PubChem CID 18296904) has the molecular formula C23H34N4O8 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18296904 |
| Molecular Formula | C23H34N4O8 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxypropanoyl]amino]pentanedioic acid |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CO)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H34N4O8/c1-3-13(2)19(24)22(33)26-16(11-14-7-5-4-6-8-14)20(31)27-17(12-28)21(32)25-15(23(34)35)9-10-18(29)30/h4-8,13,15-17,19,28H,3,9-12,24H2,1-2H3,(H,25,32)(H,26,33)(H,27,31)(H,29,30)(H,34,35) |
| InChIKey | COQAWYPVJQXUEZ-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 208.15 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |