C24H39N5O6 — CID 18297667
6-amino-2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 18297667) has the molecular formula C24H39N5O6 and a molecular weight of 493.61 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18297667 |
| Molecular Formula | C24H39N5O6 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(N)C(=O)NC(CO)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C24H39N5O6/c1-3-15(2)20(26)23(33)29-19(14-30)22(32)28-18(13-16-9-5-4-6-10-16)21(31)27-17(24(34)35)11-7-8-12-25/h4-6,9-10,15,17-20,30H,3,7-8,11-14,25-26H2,1-2H3,(H,27,31)(H,28,32)(H,29,33)(H,34,35) |
| InChIKey | DZPJOJPURDIEIE-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|